You have no items in your shopping cart.
Cart summary
Ginkgolide B
Catalog Number: orb1305072
| Catalog Number | orb1305072 |
|---|---|
| Category | Small Molecules |
| Description | Ginkgolide B |
| CAS Number | 15291-77-7 |
| Purity | 99.39% |
| MW | 424.4 |
| SMILES | CC1C(=O)OC2C(O)C34C5CC(C(C)(C)C)C33C(O)C(=O)OC3OC4(C(=O)O5)C12O |
| Formula | C20H24O10 |
| Biological Activity | Ginkgolide B (BN-52021) is a PAFR antagonist(IC50=3.6 μM) isolated from Ginkgo biloba. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
- Item 1 of 1
