You have no items in your shopping cart.
Cart summary
Silybin B
Catalog Number: orb1684217
| Catalog Number | orb1684217 |
|---|---|
| Category | Small Molecules |
| Description | Silybin B |
| Purity | 99.66% |
| MW | 482.44 |
| Biological Activity | Silybin B (Silibinin B) is an effective inhibitor of raloxifene 4 '- and 6-glucosalylation, an effective anti-fibrinogenic and anti-oligomeric component of Silymarin, with free radical scavenging activity of 1, 1-diphenyl-2-pyridinyl hydrazine (DPPH), and a protective effect against cisplatin-induced neurotoxicity by alleviating DNA damage and apoptosis. Silybin B can inhibit the growth of human chronic myeloid leukemia K562 cells and induce apoptosis. |
| CAS Number | [142797-34-0] |
| Formula | C25H22O10 |
| SMILES | COc1cc(ccc1O)[C@@H]1Oc2cc(ccc2O[C@H]1CO)[C@H]1Oc2cc(O)cc(O)c2C(=O)[C@@H]1O |
| Storage | -20°C |
| Note | For research use only |
