You have no items in your shopping cart.
Cart summary
Silybin B
Catalog Number: orb1684217
| Catalog Number | orb1684217 |
|---|---|
| Category | Small Molecules |
| Description | Silybin B |
| CAS Number | 142797-34-0 |
| Purity | 98% |
| MW | 482.44 |
| SMILES | COc1cc(ccc1O)[C@@H]1Oc2cc(ccc2O[C@H]1CO)[C@H]1Oc2cc(O)cc(O)c2C(=O)[C@@H]1O |
| Formula | C25H22O10 |
| Biological Activity | Silybin B and silybin A are potent inhibitors of both raloxifene 4'- and 6-glucuronidation in all enzyme systems; they show strong effects on cell growth inhibition and apoptosis induction in human chronic myeloid leukemia K562 cells. Silybin B exhibits 1,1-diphenyl-2-picrylhydrazyl (DPPH) radical scavenging activity. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
