You have no items in your shopping cart.
Cart summary
PPQ-102
Catalog Number: orb1307285
| Catalog Number | orb1307285 |
|---|---|
| Category | Small Molecules |
| Description | PPQ-102 |
| CAS Number | 931706-15-9 |
| Purity | 99.17% |
| MW | 438.48 |
| SMILES | Cc1ccc(o1)C1Nc2ccccc2-n2c1c1n(C)c(=O)n(C)c(=O)c1c2-c1ccccc1 |
| Formula | C26H22N4O3 |
| Biological Activity | PPQ-102 (CFTR Inhibitor), an effective CFTR inhibitor, can completely inhibit CFTR chloride current (IC50: 90 nM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
