You have no items in your shopping cart.
Cart summary
KU-55933
Catalog Number: orb1305169
| Catalog Number | orb1305169 |
|---|---|
| Category | Small Molecules |
| Description | KU-55933 |
| CAS Number | 587871-26-9 |
| Purity | 99.80% |
| MW | 395.49 |
| SMILES | O=c1cc(oc(c1)-c1cccc2Sc3ccccc3Sc12)N1CCOCC1 |
| Formula | C21H17NO3S2 |
| Biological Activity | KU-55933 (ATM Kinase Inhibitor) is a potent and specific ATM inhibitor. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
