You have no items in your shopping cart.
Cart summary
KRAS inhibitor-9
Catalog Number: orb1298658
| Catalog Number | orb1298658 |
|---|---|
| Category | Small Molecules |
| Description | KRAS inhibitor-9 |
| CAS Number | 300809-71-6 |
| Purity | 99.94% |
| MW | 292.81 |
| SMILES | Nc1ccc(Sc2nc3ccccc3s2)c(Cl)c1 |
| Formula | C13H9ClN2S2 |
| Biological Activity | KRAS inhibitor-9 (DUN09716) is a potent KRAS inhibitor with Kd of 92 μM that blocks the formation of GTP-KRAS and downstream activation of KRAS. KRAS inhibitor-9 causes G2/M cell cycle arrest and induces apoptosis. KRAS inhibitor-9 selectively inhibits the proliferation of NSC-LC cells with KRAS mutation but not normal lung cells |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
