You have no items in your shopping cart.
Cart summary
(-)-Hydroxycitric acid lactone
Catalog Number: orb1309421
| Catalog Number | orb1309421 |
|---|---|
| Category | Small Molecules |
| Description | (-)-Hydroxycitric acid lactone |
| CAS Number | 27750-13-6 |
| Purity | 99.91% |
| MW | 190.11 |
| SMILES | OC(=O)[C@H]1OC(=O)C[C@@]1(O)C(O)=O |
| Formula | C6H6O7 |
| Biological Activity | (-)-Hydroxycitric acid lactone (Garcinia lactone) is an anti-obesity agent.(-)-Hydroxycitric acid lactone was a potent inhibitor of ATP citrate lyase, which catalyzes the extramitochondrial cleavage of citrate to oxaloacetate and acetyl-CoA. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
