You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304767 |
---|---|
Category | Small Molecules |
Description | (-)-Epigallocatechin |
CAS Number | 970-74-1 |
Purity | 99.76% |
MW | 306.27 |
SMILES | O[C@H]1[C@H](OC=2C(C1)=C(O)C=C(O)C2)C3=CC(O)=C(O)C(O)=C3 |
Formula | C15H14O7 |
Biological Activity | (-)-Epigallocatechin, the predominant flavonoid in green tea, possesses the unique ability to attach to unfolded native polypeptides, thereby inhibiting their transformation into amyloid fibrils. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
83104-87-4 | |
472.4 | |
C23H20O11 |
99.34% | |
989-51-5 | |
458.37 | |
C22H18O11 |