You have no items in your shopping cart.
Cart summary
Caryophyllene oxide
Catalog Number: orb1305110
| Catalog Number | orb1305110 |
|---|---|
| Category | Small Molecules |
| Description | Caryophyllene oxide |
| Purity | 99.87% |
| MW | 220.35 |
| Biological Activity | Caryophyllene oxide is isolated from Aegle marmelos, with anti-inflammatory activity. |
| CAS Number | [1139-30-6] |
| Formula | C15H24O |
| SMILES | C[C@@]12CC[C@@H]3[C@H](CC3(C)C)C(=C)CC[C@H]1O2 |
| Storage | -20°C |
| Note | For research use only |
