You have no items in your shopping cart.
Cart summary
Betulonic acid
Catalog Number: orb1301357
| Catalog Number | orb1301357 |
|---|---|
| Category | Small Molecules |
| Description | Betulonic acid |
| Purity | 99.70% |
| MW | 454.68 |
| Biological Activity | 1. Betulonic acid (Liquidambaric acid) amide stimulated the regenerative response in hepatocytes under conditions of combined toxic exposure and promoted recovery of their qualitative and quantitative characteristics, which was accompanied by a significant decrease in the severity of liver fibrosis and the absence of cirrhotic transformation of the liver. 2. Betulonic acid derivatives have a promising cytostatic activity in vitro and could be used as potential leads for the development of new type of anti-cancer agents. 3. Betulonic acid has antiholestatic effects in mice. |
| CAS Number | [4481-62-3] |
| Formula | C30H46O3 |
| SMILES | CC(=C)[C@@H]1CC[C@@]2(CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@@]34C)[C@@H]12)C(O)=O |
| Storage | -20°C |
| Note | For research use only |
