You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1308698 |
---|---|
Category | Small Molecules |
Description | Ac4ManNAz |
Purity | 98.42% |
MW | 430.37 |
Biological Activity | Ac4ManNAz is an azido-containing metabolic glycoprotein labeling reagent. It can be used to selectively modify proteins, and it can be used in cell labeling, tracking and proteomic analysis; |
CAS Number | 361154-30-5 |
Formula | C16H22N4O10 |
SMILES | O(C(C)=O)[C@@H]1[C@H](NC(CN=[N+]=[N-])=O)C(OC(C)=O)O[C@H](COC(C)=O)[C@H]1OC(C)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
361154-30-5 | |
430.4 | |
C₁₆H₂₂N₄O₁₀ |
mass identification (ESI-MS) | |
361154-30-5 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |
mass identification (ESI-MS) | |
361154-30-5 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |
mass identification (ESI-MS) | |
361154-30-5 | |
Theoretical MW: 430.37 g/mol; Detected MW: 430.13 g/mol | |
C16H22N4O10 |