You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2893382 |
---|---|
Category | Small Molecules |
Description | 6"-apiosyl sec-O-glucosylhamaudol is a natural product that can be used in related research in the field of life sciences. Its product number is orb2893382. |
MW | 570.19 |
CAS Number | 2254096-95-0 |
Formula | C26H34O14 |
SMILES | OC1=C2C(=CC3=C1C(=O)C=C(C)O3)OC(C)(C)[C@@H](O[C@@H]4O[C@H](CO[C@H]5[C@H](O)[C@](CO)(O)CO5)[C@@H](O)[C@H](O)[C@H]4O)C2 |
Storage | -20°C |
Note | For research use only |
FC, IF, IHC-Fr, IHC-P, WB | |
Bovine, Drosophila, Porcine, Rabbit | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC | |
Rabbit | |
Goat | |
Recombinant | |
HRP |
IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Mouse | |
Monoclonal | |
Unconjugated |
FC, IF, IHC-Fr, IHC-P, WB | |
Mouse, Rat | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |