You have no items in your shopping cart.
Cart summary
Xanthopterin (hydrate)
Catalog Number: orb1308742
| Catalog Number | orb1308742 |
|---|---|
| Category | Small Molecules |
| Description | Xanthopterin (hydrate) |
| Purity | 99.79% |
| MW | 197.15 |
| Biological Activity | Xanthopterin Hydrate is isolated from butterfly wings and could replace folic acid in the nutrition of many animal species. |
| CAS Number | 5979-01-1 |
| Formula | C6H7N5O3 |
| SMILES | O.Nc1nc2ncc(=O)[nH]c2c(=O)[nH]1 |
| Storage | -20°C |
| Note | For research use only |
