You have no items in your shopping cart.
Cart summary
UM-3006
Catalog Number: orb2802104
| Catalog Number | orb2802104 |
|---|---|
| Category | Small Molecules |
| Description | UM-3006 is a potent TLR7/8 agonist that enhances immune responses by activating the TLR signaling pathway. This compound holds significant research and application potential in the fields of vaccine adjuvants and immune diseases. |
| CAS Number | 1927013-87-3 |
| MW | 390.52 |
| SMILES | C(CCCCC1CCNCC1)N2C=3C(NC2=O)=C(N)N=C(O[C@H](CCC)C)N3 |
| Formula | C20H34N6O2 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
