You have no items in your shopping cart.
Cart summary
TY-52156
Catalog Number: orb1307641
| Catalog Number | orb1307641 |
|---|---|
| Category | Small Molecules |
| Description | TY-52156 |
| CAS Number | 934369-14-9 |
| Purity | 99.91% |
| MW | 364.27 |
| SMILES | CC(C)(C)C(=O)C(\NNc1ccc(Cl)cc1)=N\c1ccc(Cl)cc1 |
| Formula | C18H19Cl2N3O |
| Biological Activity | TY-52156 is an effective and selective S1P3 receptor antagonist (Ki: 110 nM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
