You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300950 |
---|---|
Category | Small Molecules |
Description | Trelagliptin |
Purity | 98.94% |
MW | 357.38 |
Biological Activity | Trelagliptin (SYR-472) is a highly specific and long-acting DPP-4 inhibitor. |
CAS Number | [865759-25-7] |
Formula | C18H20FN5O2 |
SMILES | Cn1c(=O)cc(N2CCC[C@@H](N)C2)n(Cc2cc(F)ccc2C#N)c1=O |
Storage | -20°C |
Note | For research use only |
> 98%(HPLC) | |
1029877-94-8 | |
475.5 | |
C22H26FN5O6 |
100.00% | |
[1029877-94-8] | |
475.47 | |
C22H26FN5O6 |