You have no items in your shopping cart.
Cart summary
trans-2-Tridecene-1,13-dioic acid
Catalog Number: orb1991043
| Catalog Number | orb1991043 |
|---|---|
| Category | Small Molecules |
| Description | trans-2-Tridecene-1,13-dioic acid |
| Purity | 98.00% |
| MW | 242.315 |
| SMILES | OC(=O)CCCCCCCCC\C=C\C(O)=O |
| Formula | C13H22O4 |
| Biological Activity | trans-2-Tridecene-1,13-dioic acid is a useful organic compound for research related to life sciences and the catalog number is orb1991043. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
