You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299185 |
---|---|
Category | Small Molecules |
Description | Tianeptine |
Purity | 98.00% |
MW | 436.95 |
Biological Activity | Tianeptine (Tianeptine sodium) is a selective 5-HT uptake facilitator in vitro and in vivo. |
CAS Number | [72797-41-2] |
Formula | C21H25ClN2O4S |
SMILES | N(CCCCCCC(O)=O)C1C=2C(S(=O)(=O)N(C)C=3C1=CC=CC3)=CC(Cl)=CC2 |
Storage | -20°C |
Note | For research use only |
98.00% | |
115220-11-6 | |
430.88 | |
C19H20ClN2O4S.Na |
99.82% | |
[30123-17-2] | |
458.93 | |
C21H24ClN2NaO4S |