You have no items in your shopping cart.
Cart summary
THR-β agonist 2
Catalog Number: orb1687449
| Catalog Number | orb1687449 |
|---|---|
| Category | Small Molecules |
| Description | THR-β agonist 2 |
| CAS Number | 2440027-77-8 |
| Purity | 98% |
| MW | 443.2 |
| SMILES | N#CC1=NN(C(=O)NC1=O)C2=CC(Cl)=C(OC3=NNC(=O)C=4C=CC=CC34)C(Cl)=C2 |
| Formula | C18H8Cl2N6O4 |
| Biological Activity | THR-β agonist 2 is a potent agonist of THR-β. THR-β agonist 2 has the potential for the research of metabolic diseases such as obesity, hyperlipidemia, hypercholesterolemia, diabetes and other conditions such as steatosis and non-alcoholic steatohepatitis (NASH), atherosclerosis and other related conditions and diseases (extracted from patent WO2021121210A1, compound 3) [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
