You have no items in your shopping cart.
Cart summary
STING agonist-7
Catalog Number: orb2703417
| Catalog Number | orb2703417 |
|---|---|
| Category | Small Molecules |
| Description | STING agonist-7 is a non-nucleotide STING agonist. STING agonist-7 binds selectively to mouse STING but not human STING. STING agonist-7 penetrates cell membrane poorly. |
| MW | 336.3015833 |
| CAS Number | [2767442-46-4] |
| Formula | C17H12N4O4 |
| SMILES | O1C2C(C(=O)O)=CC=CC=2C=C1CNC(C1C=NN2C=CC=NC2=1)=O |
| Note | For research use only |
