You have no items in your shopping cart.
Cart summary
SP-146
Catalog Number: orb1298715
| Catalog Number | orb1298715 |
|---|---|
| Category | Small Molecules |
| Description | SP-146 |
| Purity | 99.47% |
| MW | 453.47 |
| SMILES | Cn1cc(cn1)c2ccc5c(c2)ncnc5Nc4cccc(NC(=O)Nc3cccc(F)c3)c4 |
| Formula | C25H20FN7O |
| Biological Activity | SP-146 is a selective, potent and non-ATP-competitive Aurora B inhibitor(IC50 : 0.316 nM). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
