You have no items in your shopping cart.
Cart summary
Sodium methylparaben
Catalog Number: orb2646176
| Catalog Number | orb2646176 |
|---|---|
| Category | Small Molecules |
| Description | Sodium methylparaben (Sodium methyl 4-hydroxybenzoate) functions as an antifungal agent. |
| CAS Number | 5026-62-0 |
| Purity | 98.00% |
| MW | 174.13 |
| SMILES | O=C(C1=CC=C(C=C1)[O-])OC.[Na+] |
| Formula | C8H7NaO3 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
