You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299900 |
---|---|
Category | Small Molecules |
Description | SDMA |
Purity | ≥98% |
MW | 202.25 |
Biological Activity | SDMA (Symmetric dimethylarginine) is the most potent endogenous inhibitor of nitric oxide synthase (NOS), with higher levels in patients with end-stage renal disease (ESRD). |
CAS Number | [30344-00-4] |
Formula | C8H18N4O2 |
SMILES | CNC(NC)=NCCC[C@H](N)C(O)=O |
Storage | -20°C |
Note | For research use only |
WB | |
Human, Mouse, Rat | |
Rabbit | |
Recombinant | |
Unconjugated |
Feline | |
0.16-10 ng/mL | |
0.052 ng/mL |
Canine | |
0.16-10 ng/mL | |
0.051 ng/mL |
Human | |
0.32-20 nmol/mL | |
0.12 nmol/mL |