You have no items in your shopping cart.
Cart summary
RORγt agonist 1
Catalog Number: orb1708653
| Catalog Number | orb1708653 |
|---|---|
| Category | Small Molecules |
| Description | RORγt agonist 1 |
| Purity | 98.00% |
| MW | 545.45 |
| Biological Activity | RORγt agonist 1 is a potent, orally bioavailable agonist of RORγt(EC50 of 20.8 nM). |
| CAS Number | 2377378-89-5 |
| Formula | C24H17F6NO5S |
| SMILES | S(=O)(=O)(N1C=2C(CC1CC(O)=O)=CC=C(C2)C3=CC(OC(F)F)=CC(F)=C3)C4=CC(C(F)(F)F)=CC=C4 |
| Storage | -20°C |
| Note | For research use only |
