You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1695663 |
---|---|
Category | Small Molecules |
Description | Rapastinel |
Purity | 99.67% |
MW | 413.47 |
Biological Activity | Rapastinel (TPPT-amide) (GLYX-13) is an N-methyl-D-aspartate receptor (NMDAR) modulator. |
CAS Number | [117928-94-6] |
Formula | C18H31N5O6 |
SMILES | C[C@@H](O)[C@H](N)C(=O)N1CCC[C@H]1C(=O)N1CCC[C@H]1C(=O)N[C@@H]([C@@H](C)O)C(N)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
117928-94-6 | |
413.5 | |
C18H31N5O6 |
99.96% | |
1435786-04-1 | |
527.49 | |
C20H32F3N5O8 |
99.60% | |
491872-39-0 | |
473.52 | |
C20H35N5O8 |