You have no items in your shopping cart.
Cart summary
(Rac)-Antineoplaston A10
Catalog Number: orb1301840
| Catalog Number | orb1301840 |
|---|---|
| Category | Small Molecules |
| Description | (Rac)-Antineoplaston A10 |
| CAS Number | 77658-84-5 |
| Purity | 98.47% |
| MW | 246.26 |
| SMILES | O=C(Cc1ccccc1)NC1CCC(=O)NC1=O |
| Formula | C13H14N2O3 |
| Biological Activity | (Rac)-Antineoplaston A10 (Antineoplaston A10) is a naturally occurring substance and the first antineoplaston in the human body to be chemically identified. It displayed anti-proliferative action inhibiting cell growth. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
