You have no items in your shopping cart.
Cart summary
Purpurin 18 methyl ester
Catalog Number: orb1943418
| Catalog Number | orb1943418 |
|---|---|
| Category | Small Molecules |
| Description | Purpurin 18 methyl ester, a derivative of chlorophyll-a, serves as a photosensitizer for photodynamic therapy (PDT), exhibiting the ability to induce cancer cell apoptosis [1]. |
| CAS Number | 51744-55-9 |
| Purity | 98.00% |
| MW | 578.66 |
| SMILES | O=C1C=2C3=C(C(C)=C(N3)C=C4C(CC)=C(C)C(=N4)C=C5NC(=CC6=NC2[C@@H](CCC(OC)=O)[C@@H]6C)C(C)=C5C=C)C(=O)O1 |
| Formula | C34H34N4O5 |
| Biological Activity | Purpurin 18 methyl ester, a derivative of chlorophyll-a, serves as a photosensitizer for photodynamic therapy (PDT), exhibiting the ability to induce cancer cell apoptosis [1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
