You have no items in your shopping cart.
Cart summary
Pparδ agonist 1
Catalog Number: orb1708820
| Catalog Number | orb1708820 |
|---|---|
| Category | Small Molecules |
| Description | Pparδ agonist 1 |
| Purity | 98.00% |
| MW | 433.5 |
| Biological Activity | Pparδ agonist 1 is an agonist of PPAR-δ(EC50 of 5.06 nM). |
| CAS Number | 1902161-12-9 |
| Formula | C26H27NO5 |
| SMILES | C(N(CC1=C(OC/C=C(/CCC(O)=O)\C)C=CC=C1)C)(=O)C2=CC=C(C=C2)C3=CC=CO3 |
| Storage | -20°C |
| Note | For research use only |
