You have no items in your shopping cart.
Cart summary
NV-5138
Catalog Number: orb1309310
| Catalog Number | orb1309310 |
|---|---|
| Category | Small Molecules |
| Description | NV-5138 |
| CAS Number | 2095886-80-7 |
| Purity | 98% |
| MW | 181.18 |
| SMILES | CC(C)(C[C@H](N)C(O)=O)C(F)F |
| Formula | C7H13F2NO2 |
| Biological Activity | NV-5138 is a selective and orally active activator of brain mTORC1, with antidepressant effects. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
