You have no items in your shopping cart.
Cart summary
NLRP3-IN-28
Catalog Number: orb2565665
| Catalog Number | orb2565665 |
|---|---|
| Category | Small Molecules |
| Description | NLRP3-IN-28 (compound N77) serves as a potent inhibitor of NLRP3, effectively blocking Nigericin-induced pyroptosis with an EC50 of 0.07μM. Additionally, it mitigates inflammatory reactions in vivo [1]. |
| CAS Number | 2922814-80-8 |
| Purity | 98.00% |
| MW | 318.27 |
| SMILES | OC1=C(C2=CC=C(S(C)(=O)=O)N=N2)C=CC(C(F)(F)F)=C1 |
| Formula | C12H9F3N2O3S |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
