You have no items in your shopping cart.
Cart summary
Myclobutanil hydroxide
Catalog Number: orb1738139
| Catalog Number | orb1738139 |
|---|---|
| Category | Small Molecules |
| Description | Myclobutanil hydroxide |
| CAS Number | 116928-93-9 |
| Purity | 0.98 |
| MW | 304.77 |
| SMILES | C(CN1C=NC=N1)(CCC(C)O)(C#N)C2=CC=C(Cl)C=C2 |
| Formula | C15H17ClN4O |
| Biological Activity | Myclobutanil hydroxide is a 14-α demethylase inhibitor that inhibits ergosterol synthesis and fungal cell wall formation. It also weakly inhibits testosterone production. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
