You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300364 |
---|---|
Category | Small Molecules |
Description | MRT68921 |
CAS Number | 1190379-70-4 |
Purity | 98.00% |
MW | 434.58 |
SMILES | N(CCCNC(=O)C1CCC1)C=2C(=CN=C(NC=3C=C4C(=CC3)CN(C)CC4)N2)C5CC5 |
Formula | C25H34N6O |
Biological Activity | MRT68921 is a potent and dual autophagy kinase ULK1/2 inhibitor with IC50 of 2.9 nM and 1.1 nM, respectively. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.15% | |
2070014-87-6 | |
471.04 | |
C25H35ClN6O |
98.98% | |
2080306-21-2 | |
507.499 | |
C25H36Cl2N6O |
[1190379-70-4] | |
432.612 | |
C27H36N4O |
> 98% (HPLC) | |
2080306-21-2 | |
471 | |
C25H35ClN6O |