You have no items in your shopping cart.
Cart summary
Moxonidine
Catalog Number: orb1310011
| Catalog Number | orb1310011 |
|---|---|
| Category | Small Molecules |
| Description | Moxonidine |
| Purity | ≥98% |
| MW | 241.68 |
| Biological Activity | Moxonidine (BDF5895) is a selective agonist at the imidazoline receptor subtype 1, acting as an antihypertensive drug. |
| CAS Number | [75438-57-2] |
| Formula | C9H12ClN5O |
| SMILES | COC1=C(\N=C2\NCCN2)C(Cl)=NC(C)=N1 |
| Storage | -20°C |
| Note | For research use only |
