You have no items in your shopping cart.
Cart summary
Mepazine acetate
Catalog Number: orb1739846
| Catalog Number | orb1739846 |
|---|---|
| Category | Small Molecules |
| Description | Mepazine acetate |
| CAS Number | 24360-97-2 |
| Purity | 0.98 |
| MW | 370.51 |
| SMILES | CC(O)=O.CN1CCCC(CN2c3ccccc3Sc3ccccc23)C1 |
| Formula | C21H26N2O2S |
| Biological Activity | Mepazine acetate is a MALT1 inhibitor. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
