You have no items in your shopping cart.
Cart summary
m-PEG5-Tos
Catalog Number: orb1989162
| Catalog Number | orb1989162 |
|---|---|
| Category | Small Molecules |
| Description | m-PEG5-Tos is a PEG-based PROTAC linker derived from silybin ethers. This compound serves as an essential component in the synthesis of Silymarin[1]. |
| CAS Number | 80755-67-5 |
| Purity | 98.00% |
| MW | 406.49 |
| SMILES | Cc1ccc(cc1)S(O)(=O)=O.COCCOCCOCCOCCOCCO |
| Formula | C18H30O8S |
| Biological Activity | m-PEG5-Tos is a PEG-based PROTAC linker derived from silybin ethers. This compound serves as an essential component in the synthesis of Silymarin[1]. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
