You have no items in your shopping cart.
Cart summary
Jaligonic acid B
Catalog Number: orb2893377
| Catalog Number | orb2893377 |
|---|---|
| Category | Small Molecules |
| Description | Jaligonic acid B is a natural product that can be used in related research in the field of life sciences. Its product number is orb2893377. |
| MW | 516.68 |
| CAS Number | 2375176-78-4 |
| Formula | C30H44O7 |
| SMILES | C[C@]12[C@@]3(C)C(=C4[C@@](C(O)=O)(CC3)CC[C@@](C(O)=O)(C)C4)C=C[C@@]1([C@]5(C)[C@@](CC2)([C@@](CO)(C)[C@@H](O)[C@@H](O)C5)[H])[H] |
| Storage | -20°C |
| Note | For research use only |
