You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1306709 |
---|---|
Category | Small Molecules |
Description | ISRIB |
CAS Number | 548470-11-7 |
Purity | 99.93% |
MW | 451.34 |
SMILES | Clc1ccc(OCC(=O)NC2CCC(CC2)NC(=O)COc2ccc(Cl)cc2)cc1 |
Formula | C22H24Cl2N2O4 |
Biological Activity | ISRIB is a potent and selective PERK inhibitor. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.17% | |
1628478-15-8 | |
487.32 | |
C22H22Cl2F2N2O4 |
98.50% | |
1628478-12-5 | |
520.23 | |
C22H22Cl4N2O4 |
98.81% | |
1597403-47-8 | |
451.34 | |
C22H24Cl2N2O4 |