You have no items in your shopping cart.
Cart summary
Isorhynchophyllic acid
Catalog Number: orb1991008
| Catalog Number | orb1991008 |
|---|---|
| Category | Small Molecules |
| Description | Isorhynchophyllic acid |
| Purity | 98.00% |
| MW | 370.449 |
| Biological Activity | Isorhynchophyllic acid is a useful organic compound for research related to life sciences and the catalog number is orb1991008. |
| Formula | C21H26N2O4 |
| SMILES | CC[C@H]1CN2CCC3([C@@H]2C[C@@H]1\C(=C/OC)C(O)=O)C(=O)Nc1ccccc31 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
