You have no items in your shopping cart.
Cart summary
Isoeugenol acetate
Catalog Number: orb1304699
| Catalog Number | orb1304699 |
|---|---|
| Category | Small Molecules |
| Description | Isoeugenol acetate |
| CAS Number | 93-29-8 |
| Purity | 99.76% |
| MW | 206.24 |
| SMILES | COC1=CC(\C=C\C)=CC=C1OC(C)=O |
| Formula | C12H14O3 |
| Biological Activity | 1. Isoeugenol acetate (Acetylisoeugenol) shows good antifungal activities against R. solani and F. oxysporum. 2. Isoeugenol acetate is a mild sensitizer in vivo. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
