You have no items in your shopping cart.
Cart summary
Insecticidal agent 10
Catalog Number: orb2564429
| Catalog Number | orb2564429 |
|---|---|
| Category | Small Molecules |
| Description | Insecticidal Agent 10 (Compound 8c) serves as a chitinase inhibitor, effectively targeting OfChi-h and OfChtI with IC 50 values of 1.51 and 9.21 nM, respectively. Additionally, it restricts the growth of Ostrinia furnacalis, exhibiting an LC 50 of 22.14 mg/L. |
| CAS Number | 3026314-21-3 |
| Purity | 98.00% |
| MW | 353.38 |
| SMILES | O=C(NC(=N)NCCCN1C(=O)C=2C=CC=C3C=CC=C(C1=O)C32)NC |
| Formula | C18H19N5O3 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
