You have no items in your shopping cart.
Cart summary
IL-17A antagonist 3
Catalog Number: orb1709425
| Catalog Number | orb1709425 |
|---|---|
| Category | Small Molecules |
| Description | IL-17A antagonist 3 |
| CAS Number | 2230780-65-9 |
| Purity | 98% |
| MW | 613.11 |
| SMILES | ClC=1C2=CC(C=3C=C(C=CC3)CCC(=O)N[C@@H](C(NC)=O)CC=4C=CC(NC(=O)[C@@H](NC(=O)C=5N(C)N=CC5)C2)=CC4)=CC1 |
| Formula | C33H33ClN6O4 |
| Biological Activity | IL-17A antagonist 3 is an IL-17A antagonist. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
