You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1684535 |
---|---|
Category | Small Molecules |
Description | Hydroxycitric acid |
Purity | 98.00% |
MW | 208.12 |
Biological Activity | (-)-Hydroxycitric acid (HCA) can inhibit fat synthesis and reduces food intake, the primary mechanism of action of HCA appears to be related to its ability to act as a competitive inhibitor of the enzyme ATP-citrate lyase, which catalyzes the conversion of citrate and coenzyme A to oxaloacetate and acetyl coenzyme A (acetyl-CoA), primary building blocks of fatty acid and cholesterol synthesis. |
CAS Number | [6205-14-7] |
Formula | C6H8O8 |
SMILES | C(C(C(O)=O)O)(CC(O)=O)(C(O)=O)O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
27750-10-3 | |
208.1 | |
C6H8O8 |
> 98% (HPLC) | |
6100-05-6 | |
324.4 | |
C6H7K3O8 |
99.91% | |
27750-13-6 | |
190.11 | |
C6H6O7 |
95.00% | |
6100-05-6 | |
324.41 | |
C6H7K3O8 |