You have no items in your shopping cart.
Cart summary
hPGDS-IN-1
Catalog Number: orb1305174
| Catalog Number | orb1305174 |
|---|---|
| Category | Small Molecules |
| Description | hPGDS-IN-1 |
| CAS Number | 1234708-04-3 |
| Purity | 99.74% |
| MW | 416.43 |
| SMILES | CC(C)(O)c1nc(no1)-c1cccc(CNC(=O)c2cnc(nc2)-c2ccccn2)c1 |
| Formula | C22H20N6O3 |
| Biological Activity | hPGDS-IN-1 is a hPGDS inhibitor. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
