You have no items in your shopping cart.
Cart summary
Hoechst 33258 analog 6
Catalog Number: orb1706357
| Catalog Number | orb1706357 |
|---|---|
| Category | Small Molecules |
| Description | Hoechst 33258 analog 6 |
| Purity | 98.00% |
| MW | 536.71 |
| Biological Activity | Hoechst 33258 analog 6 is an analog of Hoechst stains which are part of a family of blue fluorescent dyes used to stain DNA. |
| CAS Number | 129244-66-2 |
| Formula | C33H40N6O |
| SMILES | CN1CCN(CC1)c1ccc2nc([nH]c2c1)-c1ccc2nc([nH]c2c1)-c1cc(c(O)c(c1)C(C)(C)C)C(C)(C)C |
| Storage | -20°C |
| Note | For research use only |
Hoechst 33258 analog 5 [orb1706358]
98.00%
23491-55-6
458.56
C29H26N6
100 mg, 50 mg, 10 mg, 5 mg, 500 mg, 200 mg
