You have no items in your shopping cart.
Cart summary
GPR35 agonist 1
Catalog Number: orb1709558
| Catalog Number | orb1709558 |
|---|---|
| Category | Small Molecules |
| Description | GPR35 agonist 1 |
| Purity | 98.00% |
| MW | 354.07 |
| Biological Activity | GPR35 agonist 1 is a highly effective and specific GPR35/CXCR8 agonist (EC50: 5.8 nM). |
| CAS Number | 2079880-92-3 |
| Formula | C10H4BrN5O5 |
| SMILES | N(=O)(=O)C1=C2C(C=C(C(=O)O2)C=3NN=NN3)=CC(Br)=C1O |
| Storage | -20°C |
| Note | For research use only |
