You have no items in your shopping cart.
Cart summary
Flavokawain B
Catalog Number: orb1300239
| Catalog Number | orb1300239 |
|---|---|
| Category | Small Molecules |
| Description | Flavokawain B |
| Purity | 100.00% |
| MW | 284.31 |
| Biological Activity | 1. Flavokawain B (Flavokavain B) has potent anti-inflammatory activity, can significantly inhibit production of NO and PGE2 in LPS-induced RAW 264.7 cells. 2. Flavokawain B, the hepatotoxic constituent from kava root, induces GSH-sensitive oxidative stress through modulation of IKK/NF-κB and MAPK signaling pathways. 3. Flavokawain B induces apoptosis, has the potential usefulness of FKB for prevention and treatment of hormone-refractory prostate cancer in an adjuvant setting. 4. Flavokawain B acts through ROS generation and GADD153 up-regulation to regulate the expression of Bcl-2 family members, thereby inducing mitochondrial dysfunction and apoptosis in HCT116 cells. |
| CAS Number | [1775-97-9] |
| Formula | C17H16O4 |
| SMILES | COC1=CC(OC)=C(C(=O)\C=C\C2=CC=CC=C2)C(O)=C1 |
| Storage | -20°C |
| Note | For research use only |
Flavokawain B [orb1225916]
> 98% (HPLC)
1775-97-9
284.3
C17H16O4
10 mg, 5 mg, 25 mg, 50 mg, 100 mg, 500 mg, 1 g
