You have no items in your shopping cart.
Cart summary
(-)-Englerin B
Catalog Number: orb2279300
| Catalog Number | orb2279300 |
|---|---|
| Category | Small Molecules |
| Description | (-)-Englerin B is a natural product that can be used as a reference standard. |
| Purity | 98.00% |
| MW | 384.516 |
| SMILES | CC(C)[C@@]12C[C@@H](O)[C@@](C)(O1)[C@@H]1CC[C@@H](C)C1[C@@H]2OC(=O)\C=C\c1ccccc1 |TLB:6:5:16.15.10:9,THB:11:10:9:4.5,13:15:9:4.5,17:16:9:4.5| |
| Formula | C24H32O4 |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
