You have no items in your shopping cart.
Cart summary
DL-Panthenol
Catalog Number: orb1308759
| Catalog Number | orb1308759 |
|---|---|
| Category | Small Molecules |
| Description | DL-Panthenol |
| Purity | 99.63% |
| MW | 205.25 |
| Biological Activity | DL-Panthenol (DL-Pantothenyl alcohol) is the alcohol analog of pantothenic acid (vitamin B5) and is thus a provitamin of B5. In organisms, it is quickly oxidized to pantothenate. |
| CAS Number | 16485-10-2 |
| Formula | C9H19NO4 |
| SMILES | C(C(NCCCO)=O)(C(CO)(C)C)O |
| Storage | -20°C |
| Note | For research use only |
