You have no items in your shopping cart.
Cart summary
Diphenmanil methylsulfate
Catalog Number: orb1310460
| Catalog Number | orb1310460 |
|---|---|
| Category | Small Molecules |
| Description | Diphenmanil methylsulfate |
| CAS Number | 62-97-5 |
| Purity | 99.85% |
| MW | 389.51 |
| SMILES | COS([O-])(=O)=O.C[N+]1(C)CCC(CC1)=C(c1ccccc1)c1ccccc1 |
| Formula | C21H27NO4S |
| Biological Activity | Diphenmanil methylsulfate (Diphemanil mesylate), a quaternary ammonium anticholinergic, binds muscarinic acetylcholine receptors and thus decreases secretory excretion of stomach acids, sweat, and saliva. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
