You have no items in your shopping cart.
Cart summary
Dimethyl 4-hydroxyisophthalate
Catalog Number: orb1299235
| Catalog Number | orb1299235 |
|---|---|
| Category | Small Molecules |
| Description | Dimethyl 4-hydroxyisophthalate |
| CAS Number | 5985-24-0 |
| Purity | 99.36% |
| MW | 210.18 |
| SMILES | C(OC)(=O)C1=CC(C(OC)=O)=CC=C1O |
| Formula | C10H10O5 |
| Biological Activity | Dimethyl 4-hydroxyisophthalate (Dimetghyl 4-Hydroxyisophthalate) is a methyl salicylate analogue, used as a building block in the chemical synthesis. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
