You have no items in your shopping cart.
Cart summary
(-)-Dihydroguaiaretic acid
Catalog Number: orb1990759
| Catalog Number | orb1990759 |
|---|---|
| Category | Small Molecules |
| Description | (-)-Dihydroguaiaretic acid |
| Purity | 98.00% |
| MW | 330.424 |
| Biological Activity | (-)-Dihydroguaiaretic acid is a useful organic compound for research related to life sciences and the catalog number is orb1990759. |
| Formula | C20H26O4 |
| SMILES | COc1cc(C[C@@H](C)[C@H](C)Cc2ccc(O)c(OC)c2)ccc1O |
| Storage | -20°C |
| Note | For research use only |
